ChemNet > CAS > 175205-01-3 2-[(6-methoxy-3-nitro-2-pyridyl)thio]propanoic acid
175205-01-3 2-[(6-methoxy-3-nitro-2-pyridyl)thio]propanoic acid
| product Name |
2-[(6-methoxy-3-nitro-2-pyridyl)thio]propanoic acid |
| CAS No |
175205-01-3 |
| Synonyms |
2-[(6-methoxy-3-nitropyridin-2-yl)sulfanyl]propanoic acid |
| Molecular Formula |
C9H10N2O5S |
| Molecular Weight |
258.2511 |
| InChI |
InChI=1/C9H10N2O5S/c1-5(9(12)13)17-8-6(11(14)15)3-4-7(10-8)16-2/h3-5H,1-2H3,(H,12,13) |
| Molecular Structure |
![175205-01-3 2-[(6-methoxy-3-nitro-2-pyridyl)thio]propanoic acid](https://images-a.chemnet.com/suppliers/chembase/314/31465.gif)
|
| Density |
1.47g/cm3 |
| Melting point |
196℃ |
| Boiling point |
434.5°C at 760 mmHg |
| Refractive index |
1.605 |
| Flash point |
216.6°C |
| Vapour Pressur |
2.56E-08mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
